
CAS 127810-64-4
:8-Bromo-2-naphthaleneacetonitrile
Description:
8-Bromo-2-naphthaleneacetonitrile is an organic compound characterized by its naphthalene structure, which is a fused bicyclic aromatic hydrocarbon. The presence of a bromine atom at the 8-position of the naphthalene ring introduces significant electrophilic properties, making it a useful intermediate in various chemical syntheses. The acetonitrile functional group (-C≡N) attached to the 2-position of the naphthalene contributes to its reactivity, particularly in nucleophilic substitution reactions. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. Its unique structure allows it to participate in diverse chemical reactions, including cross-coupling reactions and as a building block in the synthesis of pharmaceuticals and agrochemicals. Additionally, the bromine substituent can facilitate further functionalization, enhancing its utility in synthetic organic chemistry. Safety data should be consulted, as brominated compounds can pose health risks, and appropriate handling procedures should be followed.
Formula:C12H8BrN
InChI:InChI=1S/C12H8BrN/c13-12-3-1-2-10-5-4-9(6-7-14)8-11(10)12/h1-5,8H,6H2
InChI key:InChIKey=NPKPNXSRHQJEEU-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=CC(CC#N)=C2)C=CC1
Synonyms:- 2-Naphthaleneacetonitrile, 8-bromo-
- 8-Bromo-2-naphthaleneacetonitrile
- 2-(8-Bromonaphthalen-2-yl)acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.