CAS 127812-08-2: Tetrakiscarboxymethyloxyphenylporphine
Description:Tetrakiscarboxymethyloxyphenylporphine is a synthetic porphyrin derivative characterized by its complex structure, which includes a porphyrin core with four carboxymethyloxyphenyl substituents. This compound exhibits unique optical properties, including strong absorption in the visible region, making it useful in various applications such as photodynamic therapy, solar energy conversion, and as a dye in biological imaging. The presence of carboxymethyloxy groups enhances its solubility in polar solvents and allows for potential interactions with biological molecules. Additionally, the porphyrin framework contributes to its ability to participate in redox reactions, which is significant in catalysis and sensing applications. Its stability and reactivity can be influenced by the surrounding environment, including pH and the presence of metal ions, which can coordinate to the porphyrin ring. Overall, Tetrakiscarboxymethyloxyphenylporphine is a versatile compound with promising applications in chemistry and biochemistry due to its structural and electronic properties.
Formula:C52H38N4O12
InChI:InChI=1/C52H38N4O12/c57-45(58)25-65-33-9-1-29(2-10-33)49-37-17-19-39(53-37)50(30-3-11-34(12-4-30)66-26-46(59)60)41-21-23-43(55-41)52(32-7-15-36(16-8-32)68-28-48(63)64)44-24-22-42(56-44)51(40-20-18-38(49)54-40)31-5-13-35(14-6-31)67-27-47(61)62/h1-24,53,56H,25-28H2,(H,57,58)(H,59,60)(H,61,62)(H,63,64)/b49-37-,49-38-,50-39-,50-41-,51-40-,51-42-,52-43-,52-44-
- Synonyms:
- 5,10,15,20-Tetrakis(4-carboxymethyloxyphenyl)-21H,23H-porphine
- 2,2',2'',2'''-[Porphyrin-5,10,15,20-Tetrayltetrakis(Benzene-4,1-Diyloxy)]Tetraacetic Acid