CAS 127817-85-0

4-METHOXY-2-(TRIFLUOROMETHYL)BENZOIC ACID

Description:

4-Methoxy-2-(trifluoromethyl)benzoic acid, with the CAS number 127817-85-0, is an aromatic carboxylic acid characterized by the presence of a methoxy group (-OCH3) and a trifluoromethyl group (-CF3) attached to a benzene ring. This compound typically exhibits a white to off-white crystalline solid form and is known for its relatively high stability due to the electron-withdrawing nature of the trifluoromethyl group, which can influence its reactivity and solubility. The methoxy group can enhance its lipophilicity, making it more soluble in organic solvents. This compound is often utilized in organic synthesis and pharmaceutical research, particularly in the development of agrochemicals and pharmaceuticals, due to its unique electronic properties and potential biological activity. Its melting point, boiling point, and specific reactivity can vary based on environmental conditions and the presence of other chemical species. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₇F₃O₃

InChI: InChI=1/C9H7F3O3/c1-15-5-2-3-6(8(13)14)7(4-5)9(10,11)12/h2-4H,1H3,(H,13,14)

SMILES: COc1ccc(c(c1)C(F)(F)F)C(=O)O

Synonyms:

• Rarechem Al Be 1192

Benzoic acid, 4-methoxy-2-(trifluoromethyl)-

CAS: 127817-85-0

Formula: C₉H₇F₃O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 220.1453

Ref: IN-DA000XFJ

4-Methoxy-2-(trifluoromethyl)benzoic acid

CAS: 127817-85-0

4-Methoxy-2-(trifluoromethyl)benzoic acid

Formula: C₉H₇F₃O₃

Purity: 98%

Color and Shape: off-white solid

Molecular weight: 220.15g/mol

Ref: 54-PC3498

4-Methoxy-2-(trifluoromethyl)benzoic acid

CAS: 127817-85-0

4-Methoxy-2-(trifluoromethyl)benzoic acid is a useful building block for the synthesis of various organic compounds. It is used in the preparation of pharmaceuticals, agrochemicals, and pesticides. 4-Methoxy-2-(trifluoromethyl)benzoic acid is also a reagent for many organic reactions, such as Friedel–Crafts reactions, Grignard reactions, and alkylation reactions. It is also an intermediate for the synthesis of other compounds.

Formula: C₉H₇F₃O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 220.15 g/mol

Ref: 3D-FM70024

4-Methoxy-2-(trifluoromethyl)benzoic acid

CAS: 127817-85-0

Formula: C₉H₇F₃O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 220.147

Ref: 10-F033766