CAS 127817-85-0
:4-METHOXY-2-(TRIFLUOROMETHYL)BENZOIC ACID
Description:
4-Methoxy-2-(trifluoromethyl)benzoic acid, with the CAS number 127817-85-0, is an aromatic carboxylic acid characterized by the presence of a methoxy group (-OCH3) and a trifluoromethyl group (-CF3) attached to a benzene ring. This compound typically exhibits a white to off-white crystalline solid form and is known for its relatively high stability due to the electron-withdrawing nature of the trifluoromethyl group, which can influence its reactivity and solubility. The methoxy group can enhance its lipophilicity, making it more soluble in organic solvents. This compound is often utilized in organic synthesis and pharmaceutical research, particularly in the development of agrochemicals and pharmaceuticals, due to its unique electronic properties and potential biological activity. Its melting point, boiling point, and specific reactivity can vary based on environmental conditions and the presence of other chemical species. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H7F3O3
InChI:InChI=1/C9H7F3O3/c1-15-5-2-3-6(8(13)14)7(4-5)9(10,11)12/h2-4H,1H3,(H,13,14)
SMILES:COc1ccc(c(c1)C(F)(F)F)C(=O)O
Synonyms:- Rarechem Al Be 1192
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 4-methoxy-2-(trifluoromethyl)-
CAS:Formula:C9H7F3O3Purity:98%Color and Shape:SolidMolecular weight:220.14534-Methoxy-2-(trifluoromethyl)benzoic acid
CAS:4-Methoxy-2-(trifluoromethyl)benzoic acidFormula:C9H7F3O3Purity:98%Color and Shape: off-white solidMolecular weight:220.15g/mol4-Methoxy-2-(trifluoromethyl)benzoic acid
CAS:4-Methoxy-2-(trifluoromethyl)benzoic acid is a useful building block for the synthesis of various organic compounds. It is used in the preparation of pharmaceuticals, agrochemicals, and pesticides. 4-Methoxy-2-(trifluoromethyl)benzoic acid is also a reagent for many organic reactions, such as Friedel–Crafts reactions, Grignard reactions, and alkylation reactions. It is also an intermediate for the synthesis of other compounds.Formula:C9H7F3O3Purity:Min. 95%Color and Shape:PowderMolecular weight:220.15 g/mol4-Methoxy-2-(trifluoromethyl)benzoic acid
CAS:Formula:C9H7F3O3Purity:98%Color and Shape:SolidMolecular weight:220.147



