CymitQuimica logo

CAS 127827-52-5

:

6-Bromo-7-fluoroquinoline

Description:
6-Bromo-7-fluoroquinoline is a heterocyclic organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a benzene ring and a pyridine ring. The presence of bromine and fluorine substituents at the 6 and 7 positions, respectively, enhances its chemical reactivity and potential biological activity. This compound typically exhibits a pale yellow to light brown appearance and is sparingly soluble in water but more soluble in organic solvents. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as quinoline derivatives are known for their antimicrobial, antimalarial, and anticancer properties. The compound's reactivity can be attributed to the electron-withdrawing effects of the halogen substituents, which can influence its interaction with biological targets. Additionally, the presence of these halogens may also affect the compound's lipophilicity and pharmacokinetic properties, making it a subject of interest in drug design and development.
Formula:C9H5BrFN
InChI:InChI=1S/C9H5BrFN/c10-7-4-6-2-1-3-12-9(6)5-8(7)11/h1-5H
InChI key:InChIKey=IFIKQQLFQMNCRN-UHFFFAOYSA-N
SMILES:BrC1=CC2=C(C=C1F)N=CC=C2
Synonyms:
  • 6-Bromo-7-fluoroquinoline
  • Quinoline, 6-bromo-7-fluoro-
Found 4 products.