CAS 127839-47-8
:1-Bromo-2-methyldecane
Description:
1-Bromo-2-methyldecane is an organic compound classified as a haloalkane, specifically a bromoalkane, due to the presence of a bromine atom in its structure. It features a straight-chain alkane backbone with a total of ten carbon atoms, making it a decane derivative. The "2-methyl" designation indicates that there is a methyl group (–CH₃) attached to the second carbon of the decane chain. This compound is typically a colorless to pale yellow liquid at room temperature and is characterized by its hydrophobic nature, making it insoluble in water but soluble in organic solvents. Its molecular structure contributes to its reactivity, particularly in nucleophilic substitution reactions, where the bromine atom can be replaced by various nucleophiles. Additionally, 1-bromo-2-methyldecane may exhibit moderate volatility and can be flammable. Safety precautions should be taken when handling this compound, as it may pose health risks through inhalation or skin contact.
Formula:C11H23Br
InChI:InChI=1S/C11H23Br/c1-3-4-5-6-7-8-9-11(2)10-12/h11H,3-10H2,1-2H3
InChI key:InChIKey=CFGVIMLEZTZTTI-UHFFFAOYSA-N
SMILES:C(CCC(CBr)C)CCCCC
Synonyms:- Decane, 1-bromo-2-methyl-
- 1-Bromo-2-methyldecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
