CAS 127842-71-1
:2-Propenoic acid, 3-[2-(difluoromethoxy)phenyl]-, (E)-
Description:
2-Propenoic acid, 3-[2-(difluoromethoxy)phenyl]-, (E)-, also known by its CAS number 127842-71-1, is an organic compound characterized by its structure, which includes a propenoic acid moiety and a difluoromethoxy-substituted phenyl group. This compound features a double bond in the propenoic acid part, indicating its potential for polymerization and reactivity in various chemical reactions. The presence of the difluoromethoxy group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and materials science. The (E)- configuration denotes the specific geometric arrangement of substituents around the double bond, which can significantly affect the compound's reactivity and interaction with biological targets. Additionally, the compound's properties, such as solubility, boiling point, and stability, are influenced by its functional groups and overall molecular structure, making it a subject of study in various chemical applications, including synthesis and drug development.
Formula:C10H8F2O3
InChI:InChI=1S/C10H8F2O3/c11-10(12)15-8-4-2-1-3-7(8)5-6-9(13)14/h1-6,10H,(H,13,14)/b6-5+
InChI key:InChIKey=KLWSPVZYBMMDBR-AATRIKPKSA-N
SMILES:O(C(F)F)C1=C(/C=C/C(O)=O)C=CC=C1
Synonyms:- (2E)-3-[2-(Difluoromethoxy)phenyl]acrylic acid
- (2E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoic acid
- 2-Propenoic acid, 3-[2-(difluoromethoxy)phenyl]-, (2E)-
- 2-Propenoic acid, 3-[2-(difluoromethoxy)phenyl]-, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
