CAS 127854-51-7

5-Thio-α-D-mannopyranose

Description:

5-Thio-α-D-mannopyranose is a sulfur-containing derivative of the sugar mannose, characterized by the presence of a thiol group at the 5-position of the pyranose ring. This modification imparts unique chemical properties, including increased reactivity and potential for forming disulfide bonds, which can be significant in biochemical applications. The compound is typically a white to off-white solid and is soluble in water due to the hydroxyl groups present in its structure. Its molecular formula reflects the typical composition of a monosaccharide, with the thiol group contributing to its distinct reactivity. 5-Thio-α-D-mannopyranose can participate in various chemical reactions, including glycosylation and redox reactions, making it of interest in synthetic organic chemistry and biochemistry. Additionally, its structural similarity to natural sugars allows it to interact with biological systems, potentially influencing cellular processes. As with many thiol-containing compounds, it may exhibit antioxidant properties, further expanding its potential applications in research and industry.

Formula: C₆H₁₂O₅S

InChI: InChI=1S/C6H12O5S/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5+,6+/m1/s1

InChI key: InChIKey=KNWYARBAEIMVMZ-PQMKYFCFSA-N

SMILES: C(O)[C@@H]1[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)S1

Synonyms:

• α-D-Mannopyranose, 5-thio-
• 2H-Thiopyran, α-D-mannopyranose deriv.
• 5-Thio-α-D-mannopyranose

5-Thio-a-D-mannose

CAS: 127854-51-7

5-Thio-a-D-mannose is a disaccharide that contains a sulfhydryl group. It has been shown to be a cellular and trackable molecule, which can be acetylated by mercuric chloride. The glycosidases of this molecule are mannosidases, which cleave the 5th carbon from the glycosidic linkage of the sugar. This is an important process for a variety of biological functions, such as the synthesis of DNA and proteins. In addition, this disaccharide is involved in various metabolic pathways, including glycolysis and gluconeogenesis.

Formula: C₆H₁₂O₅S

Purity: Min. 95%

Molecular weight: 196.22 g/mol

Ref: 3D-MT63576