CymitQuimica logo

CAS 127861-40-9

:

Benz[j]aceanthrylen-2(1H)-one, 9,10-dihydro-9,10-dihydroxy-3-methyl-, (9R-trans)-

Description:
Benz[j]aceanthrylen-2(1H)-one, 9,10-dihydro-9,10-dihydroxy-3-methyl-, (9R-trans)-, with CAS number 127861-40-9, is a polycyclic aromatic compound characterized by its complex fused ring structure. This compound features a ketone functional group and multiple hydroxyl groups, which contribute to its chemical reactivity and potential biological activity. The presence of the methyl group indicates that it has a specific substitution pattern that can influence its physical properties, such as solubility and melting point. The stereochemistry, denoted by (9R-trans)-, suggests a specific three-dimensional arrangement of atoms, which can affect the compound's interactions with biological systems. Generally, compounds of this nature may exhibit interesting properties, including fluorescence and potential applications in organic electronics or as intermediates in synthetic chemistry. However, detailed studies are necessary to fully understand its reactivity, stability, and potential applications in various fields, including medicinal chemistry and materials science.
Formula:C21H16O3
InChI:InChI=1S/C21H16O3/c1-10-2-3-11-8-15-12-6-7-17(22)21(24)14(12)5-4-13(15)16-9-18(23)19(10)20(11)16/h2-8,17,21-22,24H,9H2,1H3/t17-,21-/m1/s1
InChI key:InChIKey=UALOIRUKSTWXFU-DYESRHJHSA-N
SMILES:O=C1C=2C3=C(C=4C(C=C3C=CC2C)=C5C(=CC4)[C@@H](O)[C@H](O)C=C5)C1
Synonyms:
  • Benz[j]aceanthrylen-2(1H)-one, 9,10-dihydro-9,10-dihydroxy-3-methyl-, (9R-trans)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.