CymitQuimica logo

CAS 1278662-49-9

:

2-(3-Bromophenyl)cyclopropanemethanol

Description:
2-(3-Bromophenyl)cyclopropanemethanol is an organic compound characterized by its cyclopropane structure, which is a three-membered carbon ring, and a bromophenyl group attached to it. The presence of the bromine atom on the phenyl ring introduces significant polarity and can influence the compound's reactivity and solubility. This compound typically exhibits properties associated with alcohols due to the hydroxyl (-OH) group, which can participate in hydrogen bonding, affecting its boiling point and solubility in polar solvents. The bromine substituent can also enhance electrophilic reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the unique cyclopropane moiety may impart strain, influencing the compound's stability and reactivity. Overall, 2-(3-Bromophenyl)cyclopropanemethanol is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or materials science due to its distinctive structural features.
Formula:C10H11BrO
InChI:InChI=1S/C10H11BrO/c11-9-3-1-2-7(4-9)10-5-8(10)6-12/h1-4,8,10,12H,5-6H2
InChI key:InChIKey=HNPYNZPAPFEJFT-UHFFFAOYSA-N
SMILES:C(O)C1C(C1)C2=CC(Br)=CC=C2
Synonyms:
  • 2-(3-Bromophenyl)cyclopropanemethanol
  • Cyclopropanemethanol, 2-(3-bromophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.