CAS 127903-20-2

6-(fmoc-amino)-1-hexanol

Description:

6-(Fmoc-amino)-1-hexanol is a chemical compound characterized by its structure, which includes a hexanol backbone with a fluorenylmethyloxycarbonyl (Fmoc) protecting group attached to the amino group. This compound is typically used in peptide synthesis as a building block, where the Fmoc group serves as a protective moiety for the amino group, allowing for selective reactions during the synthesis process. The presence of the hexanol chain contributes to its hydrophobic characteristics, which can influence solubility and reactivity in various solvents. Additionally, the Fmoc group is known for its stability under basic conditions and can be removed under mild acidic conditions, making it a popular choice in solid-phase peptide synthesis. The compound's molecular structure allows for potential applications in medicinal chemistry and materials science, particularly in the development of peptide-based therapeutics and functional materials. Its properties, such as melting point, solubility, and reactivity, can vary depending on the specific conditions and solvents used in experiments.

Formula: C₂₁H₂₅NO₃

InChI: InChI=1/C21H25NO3/c23-14-8-2-1-7-13-22-21(24)25-15-20-18-11-5-3-9-16(18)17-10-4-6-12-19(17)20/h3-6,9-12,20,23H,1-2,7-8,13-15H2,(H,22,24)

SMILES: C(CCCO)CCN=C(O)OCC1c2ccccc2c2ccccc12

Synonyms:

• 9H-Fluoren-9-ylmethyl N-(6-hydroxyhexyl)carbamate
• 9H-fluoren-9-ylmethyl (6-hydroxyhexyl)carbamate

6-(Fmoc-amino)-1-hexanol

CAS: 127903-20-2

Formula: C₂₁H₂₅NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 339.4281

Ref: IN-DA000XJA

N-(Fluoren-9-ylmethoxycarbonyl)-6-aminohexan-1-ol

CAS: 127903-20-2

N-(Fluoren-9-ylmethoxycarbonyl)-6-aminohexan-1-ol

Purity: ≥95%

Color and Shape: White Powder

Molecular weight: 339.43g/mol

Ref: 54-OR0485

6-(Fmoc-amino)-1-hexanol

CAS: 127903-20-2

6-(Fmoc-amino)-1-hexanol is a high quality chemical that can be used as an intermediate in the synthesis of many complex compounds, such as pharmaceuticals, fine chemicals and research chemicals. It is often used as a building block in the synthesis of other useful chemicals and has been shown to have versatile reactions with many functional groups. 6-(Fmoc-amino)-1-hexanol can be used in reactions involving nucleophilic substitution, elimination, amination, esterification and transesterification.

Formula: C₂₁H₂₅NO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 339.43 g/mol

Ref: 3D-FF49780

6-(Fmoc-amino)-1-hexanol

CAS: 127903-20-2

Formula: C₂₁H₂₅NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 339.435

Ref: 10-F493299