CAS 1279034-29-5
:O-Ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-allothreonine
Description:
O-Ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-allothreonine is a synthetic compound primarily used in biochemical research, particularly in the field of peptide synthesis and drug development. This compound features a unique structure that includes an ethyl group, a fluorenylmethoxycarbonyl (Fmoc) protecting group, and the amino acid L-allothreonine. The Fmoc group is commonly employed in solid-phase peptide synthesis due to its stability under basic conditions and ease of removal under acidic conditions. The presence of the allothreonine moiety suggests potential applications in studying protein interactions and enzyme activity, as it can influence the conformation and reactivity of peptides. Additionally, the compound's solubility and stability characteristics make it suitable for various laboratory applications. As with many synthetic compounds, safety data and handling precautions should be observed, as the specific toxicity and environmental impact of this compound may not be fully characterized. Overall, O-Ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-allothreonine represents a valuable tool in the synthesis and study of biologically relevant molecules.
Formula:C21H23NO5
InChI:InChI=1S/C21H23NO5/c1-3-26-13(2)19(20(23)24)22-21(25)27-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,13,18-19H,3,12H2,1-2H3,(H,22,25)(H,23,24)/t13-,19-/m0/s1
InChI key:InChIKey=CUBBXMGQJYSGLW-DJJJIMSYSA-N
SMILES:C(OC(N[C@@H]([C@@H](OCC)C)C(O)=O)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:- L-Allothreonine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-
- O-Ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-allothreonine
- FMOC-(2S,3S)-2-AMINO-3-ETHOXYBUTANOIC ACID
- Fmoc-allo-Thr(Et)-OH
- FMOC-ALLO-O-ETHYL-L-THR
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.