
CAS 1279038-07-1
:L-Proline, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, methyl ester, hydrochloride (1:1), (4S)-
Description:
L-Proline, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, methyl ester, hydrochloride (1:1), (4S)- is a synthetic derivative of the amino acid proline, characterized by the presence of a fluorenylmethoxycarbonyl (Fmoc) protecting group and a methyl ester functional group. This compound is typically used in peptide synthesis and as a building block in organic chemistry due to its ability to form stable peptide bonds. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in polar solvents, making it suitable for various biochemical applications. The (4S) designation refers to the specific stereochemistry of the proline residue, which is crucial for maintaining the biological activity and structural integrity of peptides. Overall, this compound is valued for its role in facilitating the synthesis of complex peptides and proteins, contributing to research in fields such as drug development and biochemistry.
Formula:C21H22N2O4·ClH
InChI:InChI=1S/C21H22N2O4.ClH/c1-26-20(24)19-10-13(11-22-19)23-21(25)27-12-18-16-8-4-2-6-14(16)15-7-3-5-9-17(15)18;/h2-9,13,18-19,22H,10-12H2,1H3,(H,23,25);1H/t13-,19-;/m0./s1
InChI key:InChIKey=CBJVXUXVCRVKJT-VCUOZSJQSA-N
SMILES:C(OC(N[C@H]1C[C@@H](C(OC)=O)NC1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3.Cl
Synonyms:- L-Proline, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, methyl ester, hydrochloride (1:1), (4S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.