CAS 1279090-55-9
:1-(3-Chlorophenyl)-3-hydroxy-1-propanone
Description:
1-(3-Chlorophenyl)-3-hydroxy-1-propanone, identified by its CAS number 1279090-55-9, is an organic compound characterized by its structural features, which include a chlorophenyl group and a hydroxyl group attached to a propanone backbone. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the hydroxyl group suggests it may engage in hydrogen bonding, influencing its physical properties such as boiling point and solubility in polar solvents. The chlorophenyl moiety can impart unique electronic characteristics, potentially affecting the compound's reactivity and interaction with biological systems. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. This compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific uses would depend on further research into its biological activity and chemical behavior.
Formula:C9H9ClO2
InChI:InChI=1S/C9H9ClO2/c10-8-3-1-2-7(6-8)9(12)4-5-11/h1-3,6,11H,4-5H2
InChI key:InChIKey=SCCDLVLMOKFVGP-UHFFFAOYSA-N
SMILES:C(CCO)(=O)C1=CC(Cl)=CC=C1
Synonyms:- 1-(3-Chlorophenyl)-3-hydroxy-1-propanone
- 1-Propanone, 1-(3-chlorophenyl)-3-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
