CAS 127910-61-6
:1,1-Dimethylethyl (3aS,4S,6aR)-4-formyltetrahydro-2,2-dimethyl-5H-1,3-dioxolo[4,5-c]pyrrole-5-carboxylate
Description:
1,1-Dimethylethyl (3aS,4S,6aR)-4-formyltetrahydro-2,2-dimethyl-5H-1,3-dioxolo[4,5-c]pyrrole-5-carboxylate, identified by CAS number 127910-61-6, is a complex organic compound characterized by its unique structural features, including a dioxolo-pyrrole framework. This compound typically exhibits a range of functional groups, including an ester and an aldehyde, which contribute to its reactivity and potential applications in organic synthesis. The stereochemistry indicated by the (3aS,4S,6aR) notation suggests specific spatial arrangements of atoms, which can influence the compound's biological activity and interaction with other molecules. Its dimethyl and formyl substituents may enhance its solubility and reactivity, making it of interest in various chemical reactions. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature often display moderate to high polarity, affecting their behavior in different solvents. Overall, this compound's intricate structure and functional diversity make it a subject of interest in fields such as medicinal chemistry and materials science.
Formula:C13H21NO5
InChI:InChI=1S/C13H21NO5/c1-12(2,3)19-11(16)14-6-9-10(8(14)7-15)18-13(4,5)17-9/h7-10H,6H2,1-5H3/t8-,9-,10+/m1/s1
InChI key:InChIKey=WHPNXNRBVFQHLV-BBBLOLIVSA-N
SMILES:C(=O)[C@@H]1[C@]2([C@@](CN1C(OC(C)(C)C)=O)(OC(C)(C)O2)[H])[H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.