CAS 127910-62-7

5H-1,3-Dioxolo[4,5-c]pyrrole-4,5-dicarboxylic acid, tetrahydro-2,2-dimethyl-, 5-(1,1-dimethylethyl) ester, [3aS-(3aα,4β,6aα)]-

Description:

5H-1,3-Dioxolo[4,5-c]pyrrole-4,5-dicarboxylic acid, tetrahydro-2,2-dimethyl-, 5-(1,1-dimethylethyl) ester, with the CAS number 127910-62-7, is a complex organic compound characterized by its unique bicyclic structure that incorporates both dioxole and pyrrole functionalities. This compound features multiple carboxylic acid groups, which contribute to its potential acidity and reactivity. The presence of ester groups indicates that it can undergo hydrolysis, making it relevant in various chemical reactions. Its tetrahydro structure suggests saturation, which may influence its stability and solubility in different solvents. The presence of bulky substituents, such as the tert-butyl group, can affect its steric properties and reactivity, potentially enhancing its lipophilicity. This compound may find applications in organic synthesis, materials science, or as an intermediate in the production of more complex molecules. However, specific applications and properties would depend on further studies and characterization, including its behavior under various conditions and interactions with other chemical species.

Formula: C₁₃H₂₁NO₆

InChI: InChI=1S/C13H21NO6/c1-12(2,3)20-11(17)14-6-7-9(8(14)10(15)16)19-13(4,5)18-7/h7-9H,6H2,1-5H3,(H,15,16)/t7-,8+,9-/m1/s1

InChI key: InChIKey=FRDGVQODRPFOOR-HRDYMLBCSA-N

SMILES: C(O)(=O)[C@@H]1[C@]2([C@@](CN1C(OC(C)(C)C)=O)(OC(C)(C)O2)[H])[H]

Synonyms:

• 5H-1,3-Dioxolo[4,5-c]pyrrole-4,5-dicarboxylic acid, tetrahydro-2,2-dimethyl-, 5-(1,1-dimethylethyl) ester, [3aS-(3aα,4β,6aα)]-