CAS 127919-30-6

Ethyl 5-(3-fluorophenyl)-4-oxazolecarboxylate

Description:

Ethyl 5-(3-fluorophenyl)-4-oxazolecarboxylate is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of the ethyl ester group contributes to its solubility and reactivity, making it a versatile intermediate in organic synthesis. The 3-fluorophenyl substituent enhances its electronic properties, potentially influencing its reactivity and interactions in various chemical environments. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in the synthesis of pharmaceuticals or agrochemicals. Additionally, the compound's stability and reactivity can be influenced by factors such as pH, temperature, and the presence of other functional groups. As with many organic compounds, safety precautions should be taken when handling it, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.

Formula: C₁₂H₁₀FNO₃

InChI: InChI=1S/C12H10FNO3/c1-2-16-12(15)10-11(17-7-14-10)8-4-3-5-9(13)6-8/h3-7H,2H2,1H3

InChI key: InChIKey=PVKNYZFXHNFWRI-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(OC=N1)C2=CC(F)=CC=C2

Synonyms:

• 4-Oxazolecarboxylic acid, 5-(3-fluorophenyl)-, ethyl ester
• Ethyl 5-(3-fluorophenyl)-4-oxazolecarboxylate

Ethyl 5-(3-fluorophenyl)-1,3-oxazole-4-carboxylate

CAS: 127919-30-6

Versatile small molecule scaffold

Formula: C₁₂H₁₀FNO₃

Purity: Min. 95%

Molecular weight: 235.21 g/mol

Ref: 3D-CFA91930