CymitQuimica logo

CAS 1279217-37-6

:

4-Chloropyrido[2,3-c]pyridazine

Description:
4-Chloropyrido[2,3-c]pyridazine is a heterocyclic compound characterized by its fused pyridine and pyridazine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position of the pyridine ring enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a planar structure, which can facilitate interactions with biological targets, making it of interest in medicinal chemistry. Its molecular framework allows for potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. Additionally, the presence of nitrogen atoms in the ring structure can influence its electronic properties, making it a candidate for studies in coordination chemistry and material science. The compound's stability and reactivity can be influenced by the substituents on the ring, and it may undergo various chemical reactions such as nucleophilic substitutions or electrophilic aromatic substitutions. Overall, 4-Chloropyrido[2,3-c]pyridazine represents a versatile scaffold for further chemical exploration and application.
Formula:C7H4ClN3
InChI:InChI=1S/C7H4ClN3/c8-6-4-10-11-7-5(6)2-1-3-9-7/h1-4H
InChI key:InChIKey=VVLQQEJELUOWDX-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=NC1)N=CC=C2
Synonyms:
  • 4-Chloropyrido[2,3-c]pyridazine
  • Pyrido[2,3-c]pyridazine, 4-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.