CAS 1279219-36-1

Methanone, (4-aminophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)-, hydrochloride (1:1)

Description:

Methanone, (4-aminophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)-, hydrochloride (1:1), identified by CAS number 1279219-36-1, is a chemical compound characterized by its complex structure that includes a methanone functional group, an amino group, and a benzodioxin moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which may influence its solubility, stability, and reactivity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. The presence of the amino group suggests potential for hydrogen bonding and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the benzodioxin structure may impart specific pharmacological properties, possibly related to neuroactivity or other biological functions. Overall, this compound's unique characteristics make it a subject of interest for further research, particularly in the fields of drug development and organic synthesis.

Formula: C₁₅H₁₃NO₃·ClH

InChI: InChI=1S/C15H13NO3.ClH/c16-12-4-1-10(2-5-12)15(17)11-3-6-13-14(9-11)19-8-7-18-13;/h1-6,9H,7-8,16H2;1H

InChI key: InChIKey=WCJYWBJHPKODBA-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C2C(=CC1)OCCO2)C3=CC=C(N)C=C3.Cl

Synonyms:

• Methanone, (4-aminophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)-, hydrochloride (1:1)

(4-aminophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone hydrochloride

CAS: 1279219-36-1

Purity: 95.0%

Molecular weight: 291.7300109863281

Ref: 10-F495749