CAS 1279219-37-2
:5-Bromo-1H-1,2,4-triazole-3-propanamide
Description:
5-Bromo-1H-1,2,4-triazole-3-propanamide is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic ring containing three nitrogen atoms. The presence of a bromine atom at the 5-position of the triazole ring contributes to its reactivity and potential applications in various chemical reactions. The propanamide functional group indicates that the compound possesses an amide linkage, which can influence its solubility and interaction with biological systems. This compound is often studied for its potential use in pharmaceuticals, agrochemicals, and as a building block in organic synthesis due to its unique structural features. Additionally, the presence of both halogen and nitrogen functionalities may impart interesting properties such as antimicrobial or antifungal activity. As with many triazole derivatives, it may also exhibit coordination chemistry with metal ions, making it relevant in materials science and catalysis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C5H7BrN4O
InChI:InChI=1S/C5H7BrN4O/c6-5-8-4(9-10-5)2-1-3(7)11/h1-2H2,(H2,7,11)(H,8,9,10)
InChI key:InChIKey=MZEKKCJPITVCGA-UHFFFAOYSA-N
SMILES:C(CC(N)=O)C=1NC(Br)=NN1
Synonyms:- 1H-1,2,4-Triazole-3-propanamide, 5-bromo-
- 5-Bromo-1H-1,2,4-triazole-3-propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
