CAS 127926-10-7
:(1R,2S)-1,2-Dihydro-7-methyl-1,2-naphthalenediol
Description:
(1R,2S)-1,2-Dihydro-7-methyl-1,2-naphthalenediol, with CAS number 127926-10-7, is a chemical compound characterized by its naphthalene structure, which consists of two fused aromatic rings. This compound features two hydroxyl (-OH) groups attached to the naphthalene framework, specifically at the 1 and 2 positions, contributing to its diol classification. The presence of a methyl group at the 7 position adds to its complexity and influences its physical and chemical properties. The stereochemistry indicated by the (1R,2S) notation suggests specific spatial arrangements of the atoms, which can affect the compound's reactivity and interactions with biological systems. Typically, such compounds may exhibit interesting biological activities, including potential antioxidant properties, due to the presence of hydroxyl groups. The solubility, melting point, and other physical properties would depend on the molecular interactions and the environment in which the compound is studied. Overall, this compound is of interest in various fields, including organic chemistry and pharmacology, due to its structural features and potential applications.
Formula:C11H12O2
InChI:InChI=1S/C11H12O2/c1-7-2-3-8-4-5-10(12)11(13)9(8)6-7/h2-6,10-13H,1H3/t10-,11+/m0/s1
InChI key:InChIKey=ISBMHLUJIIODOL-WDEREUQCSA-N
SMILES:O[C@@H]1C=2C(C=C[C@@H]1O)=CC=C(C)C2
Synonyms:- (1R,2S)-1,2-Dihydro-7-methyl-1,2-naphthalenediol
- 1,2-Naphthalenediol, 1,2-dihydro-7-methyl-, (1R-cis)-
- 1,2-Naphthalenediol, 1,2-dihydro-7-methyl-, (1R,2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
