CymitQuimica logo

CAS 127947-14-2

:

6,6,16-trifluorohexadecanoic acid

Description:
6,6,16-Trifluorohexadecanoic acid is a perfluorinated fatty acid characterized by the presence of three fluorine atoms at the 6th carbon position and a long hydrocarbon chain consisting of 16 carbon atoms. This compound is part of a class of substances known for their unique properties, including high thermal stability, hydrophobicity, and lipophobicity, which make them resistant to degradation in the environment. The trifluoromethyl groups contribute to its chemical stability and alter its interaction with biological systems, potentially affecting its bioavailability and toxicity. As a fatty acid, it can participate in various chemical reactions, including esterification and amidation, making it relevant in the synthesis of surfactants, lubricants, and other industrial applications. However, the environmental and health implications of perfluorinated compounds are significant, as they can persist in the environment and accumulate in living organisms. Therefore, understanding the characteristics and behavior of 6,6,16-trifluorohexadecanoic acid is crucial for assessing its potential risks and applications in various fields.
Formula:C16H29F3O2
InChI:InChI=1/C16H29F3O2/c17-14-10-6-4-2-1-3-5-8-12-16(18,19)13-9-7-11-15(20)21/h1-14H2,(H,20,21)
SMILES:C(CCCCCF)CCCCC(CCCCC(=O)O)(F)F
Synonyms:
  • 6,6,16-Trifluoropalmitic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.