CymitQuimica logo

CAS 127947-16-4

:

7,7,16-trifluorohexadecanoic acid

Description:
7,7,16-Trifluorohexadecanoic acid is a perfluorinated fatty acid characterized by the presence of three fluorine atoms at the 7th carbon position and a long hydrocarbon chain consisting of 16 carbon atoms. This compound is part of a class of substances known as perfluoroalkyl acids (PFAAs), which are recognized for their unique chemical properties, including high thermal stability and resistance to degradation. The trifluoromethyl groups contribute to its hydrophobic nature, making it less soluble in water while enhancing its lipophilicity. This compound is of interest in various fields, including materials science and biochemistry, due to its potential applications in surfactants, emulsifiers, and as a building block for more complex fluorinated compounds. Additionally, its environmental persistence raises concerns regarding bioaccumulation and potential toxicity, prompting ongoing research into its behavior and effects in biological systems. Overall, 7,7,16-trifluorohexadecanoic acid exemplifies the unique characteristics and challenges associated with perfluorinated compounds.
Formula:C16H29F3O2
InChI:InChI=1/C16H29F3O2/c17-14-10-5-3-1-2-4-8-12-16(18,19)13-9-6-7-11-15(20)21/h1-14H2,(H,20,21)
SMILES:C(CCCCC(CCCCCC(=O)O)(F)F)CCCCF
Synonyms:
  • 7,7,16-Trifluoropalmitic acid
  • Hexadecanoic acid, 7,7,16-trifluoro-
  • 7,7,16-Trifluorohexadecanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.