CAS 127957-89-5
:Ethyl 2-methyl-4-propyl-5-pyrimidinecarboxylate
Description:
Ethyl 2-methyl-4-propyl-5-pyrimidinecarboxylate, identified by its CAS number 127957-89-5, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at the 1 and 3 positions. The compound is characterized by the presence of an ethyl ester functional group, which contributes to its solubility and reactivity. Its structure includes alkyl substituents, specifically a methyl group at the 2-position and a propyl group at the 4-position of the pyrimidine ring, which can influence its physical and chemical properties, such as boiling point and polarity. Ethyl 2-methyl-4-propyl-5-pyrimidinecarboxylate may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its synthesis and characterization can involve various organic chemistry techniques, including esterification and purification methods. Overall, this compound represents a unique structure with potential applications in medicinal chemistry and related fields.
Formula:C11H16N2O2
InChI:InChI=1S/C11H16N2O2/c1-4-6-10-9(11(14)15-5-2)7-12-8(3)13-10/h7H,4-6H2,1-3H3
InChI key:InChIKey=HGCRMXNQSAARKC-UHFFFAOYSA-N
SMILES:C(CC)C=1C(C(OCC)=O)=CN=C(C)N1
Synonyms:- 5-Pyrimidinecarboxylic acid, 2-methyl-4-propyl-, ethyl ester
- Ethyl 2-methyl-4-propyl-5-pyrimidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
