CymitQuimica logo

CAS 127957-90-8

:

Ethyl 2-methyl-4-(1-methylethyl)-5-pyrimidinecarboxylate

Description:
Ethyl 2-methyl-4-(1-methylethyl)-5-pyrimidinecarboxylate, with the CAS number 127957-90-8, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic compound containing two nitrogen atoms at positions 1 and 3. This substance features an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of a 2-methyl and a 4-(1-methylethyl) substituent on the pyrimidine ring indicates that it has branched alkyl groups, which can influence its physical properties such as boiling point and solubility in various solvents. Ethyl 2-methyl-4-(1-methylethyl)-5-pyrimidinecarboxylate may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis typically involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, this compound represents a unique combination of functional groups and structural features that may have applications in medicinal chemistry and related fields.
Formula:C11H16N2O2
InChI:InChI=1S/C11H16N2O2/c1-5-15-11(14)9-6-12-8(4)13-10(9)7(2)3/h6-7H,5H2,1-4H3
InChI key:InChIKey=FSNVLIRGOYBZLG-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(C(C)C)=NC(C)=NC1
Synonyms:
  • 5-Pyrimidinecarboxylic acid, 2-methyl-4-(1-methylethyl)-, ethyl ester
  • Ethyl 2-methyl-4-(1-methylethyl)-5-pyrimidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.