CAS 127958-02-5

2-Amino-4-propyl-5-pyrimidinecarboxylic acid

Description:

2-Amino-4-propyl-5-pyrimidinecarboxylic acid, with the CAS number 127958-02-5, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its properties as an amino acid derivative. The presence of the propyl group enhances its hydrophobic characteristics, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as building blocks in the development of agrochemicals. The molecular structure allows for various interactions, including hydrogen bonding, which can affect its stability and reactivity in different environments. Additionally, the compound's properties may be influenced by factors such as pH and temperature, which can affect the ionization state of the amino and carboxylic groups. Overall, 2-Amino-4-propyl-5-pyrimidinecarboxylic acid is a versatile compound with potential applications in medicinal chemistry and related fields.

Formula: C₈H₁₁N₃O₂

InChI: InChI=1S/C8H11N3O2/c1-2-3-6-5(7(12)13)4-10-8(9)11-6/h4H,2-3H2,1H3,(H,12,13)(H2,9,10,11)

InChI key: InChIKey=FYGIAJGIHGLMOC-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(CCC)=NC(N)=NC1

Synonyms:

• 5-Pyrimidinecarboxylic acid, 2-amino-4-propyl-
• 2-Amino-4-propyl-5-pyrimidinecarboxylic acid