CAS 127958-24-1
:4,5-Dihydro-4,4-dimethyl-3,5,5-triphenyl-1H-pyrazole
Description:
4,5-Dihydro-4,4-dimethyl-3,5,5-triphenyl-1H-pyrazole is a chemical compound characterized by its unique pyrazole structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features three phenyl groups and two methyl groups, contributing to its hydrophobic nature and potential for various interactions in organic synthesis and material science. The presence of multiple aromatic rings enhances its stability and may impart interesting electronic properties, making it a candidate for applications in organic electronics or as a ligand in coordination chemistry. Additionally, the dihydro form indicates that it has a saturated bond within the pyrazole ring, which can influence its reactivity and interaction with other chemical species. The compound's CAS number, 127958-24-1, allows for easy identification and retrieval of information in chemical databases. Overall, this compound's structural features suggest potential utility in pharmaceuticals, agrochemicals, or as a building block in organic synthesis.
Formula:C23H22N2
InChI:InChI=1S/C23H22N2/c1-22(2)21(18-12-6-3-7-13-18)24-25-23(22,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17,25H,1-2H3
InChI key:InChIKey=GSXLPVFIBAHFED-UHFFFAOYSA-N
SMILES:CC1(C)C(NN=C1C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- 4,5-Dihydro-4,4-dimethyl-3,5,5-triphenyl-1H-pyrazole
- 1H-Pyrazole, 4,5-dihydro-4,4-dimethyl-3,5,5-triphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
