
CAS 127958-64-9
:Hexahydro-2H-1,4-benzoxazin-3(4H)-one
Description:
Hexahydro-2H-1,4-benzoxazin-3(4H)-one, with the CAS number 127958-64-9, is a heterocyclic organic compound characterized by its bicyclic structure that includes a benzene ring fused to a saturated nitrogen-containing ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its bioactive properties. The presence of the benzoxazine moiety suggests that it may participate in various chemical reactions, including polymerization and cyclization, making it of interest in materials science. Additionally, its stability under standard conditions and the ability to undergo functionalization further enhance its utility in synthetic chemistry. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, Hexahydro-2H-1,4-benzoxazin-3(4H)-one represents a versatile compound with promising applications in research and industry.
Formula:C8H13NO2
InChI:InChI=1S/C8H13NO2/c10-8-5-11-7-4-2-1-3-6(7)9-8/h6-7H,1-5H2,(H,9,10)
InChI key:InChIKey=YPAXNOSCMMBZTF-UHFFFAOYSA-N
SMILES:O=C1NC2C(OC1)CCCC2
Synonyms:- 2H-1,4-Benzoxazin-3(4H)-one, hexahydro-
- Hexahydro-2H-1,4-benzoxazin-3(4H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
