CAS 127958-78-5

Acetic acid, 2-[(1-acetyl-3-piperidinyl)oxy]-

Description:

Acetic acid, 2-[(1-acetyl-3-piperidinyl)oxy]- is a chemical compound characterized by its functional groups and structural features. It contains an acetic acid moiety, which contributes to its acidic properties, and a piperidine ring that introduces basic characteristics due to the nitrogen atom in the ring. The presence of the acetyl group enhances its reactivity and potential for forming various derivatives. This compound is typically a colorless to pale yellow liquid with a distinctive odor, and it is soluble in water, reflecting the polar nature of its functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperidine's role in enhancing biological activity. Additionally, the compound may exhibit properties such as antimicrobial or analgesic effects, making it of interest in various therapeutic contexts. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₉H₁₅NO₄

InChI: InChI=1S/C9H15NO4/c1-7(11)10-4-2-3-8(5-10)14-6-9(12)13/h8H,2-6H2,1H3,(H,12,13)

InChI key: InChIKey=XKDHHJGQUCIMMM-UHFFFAOYSA-N

SMILES: O(CC(O)=O)C1CN(C(C)=O)CCC1

Synonyms:

• Acetic acid, 2-[(1-acetyl-3-piperidinyl)oxy]-
• (1-Acetyl-piperidin-3-yloxy)-acetic acid
• 2-[(1-Acetylpiperidin-3-yl)oxy]acetic acid
• Acetic acid, [(1-acetyl-3-piperidinyl)oxy]-