CAS 127978-70-5

(5-METHOXYPYRIDIN-2-YL)METHANOL

Description:

(5-Methoxypyridin-2-yl)methanol is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a methanol group and at the 5-position with a methoxy group. This structure imparts both polar and non-polar characteristics, making it soluble in various organic solvents while also exhibiting some hydrophilic properties due to the hydroxyl (-OH) group. The presence of the methoxy group enhances its electron-donating ability, potentially influencing its reactivity and interactions in chemical reactions. This compound may be of interest in medicinal chemistry, particularly for its potential biological activities, as pyridine derivatives are often explored for their pharmacological properties. Additionally, its molecular structure suggests it could participate in hydrogen bonding, which may affect its physical properties such as boiling point and melting point. Overall, (5-methoxypyridin-2-yl)methanol is a versatile compound with applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₇H₉NO₂

InChI: InChI=1/C7H9NO2/c1-10-7-3-2-6(5-9)8-4-7/h2-4,9H,5H2,1H3

SMILES: COc1ccc(CO)nc1

Synonyms:

• 2-Pyridinemethanol,5-methoxy-(9CI)

2-Pyridinemethanol, 5-methoxy-

CAS: 127978-70-5

Formula: C₇H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 139.1519

Ref: IN-DA000XML

(5-Methoxypyridin-2-yl)methanol

CAS: 127978-70-5

(5-Methoxypyridin-2-yl)methanol

Purity: 98%

Molecular weight: 139.15g/mol

Ref: 54-OR906110

(5-Methoxypyridine-2-yl)methanol

CAS: 127978-70-5

Formula: C₇H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 139.154

Ref: 10-F093602