CAS 1279815-47-2

3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxamide

Description:

3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxamide is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group at the 3-position and a trifluoromethyl group at the 6-position significantly influences its chemical properties, including its reactivity and polarity. The carboxamide functional group contributes to its potential as a hydrogen bond donor and acceptor, enhancing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of agrochemicals or medicinal compounds. Its molecular structure suggests potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the trifluoromethyl group is known to impart unique electronic properties, which can affect the compound's interaction with biological targets. Safety and handling precautions should be observed due to the presence of chlorine and fluorine, which can pose environmental and health risks.

Formula: C₇H₄ClF₃N₂O

InChI: InChI=1S/C7H4ClF3N2O/c8-3-1-2-4(7(9,10)11)13-5(3)6(12)14/h1-2H,(H2,12,14)

InChI key: InChIKey=QYNZPTWMUAMLJJ-UHFFFAOYSA-N

SMILES: C(N)(=O)C=1N=C(C(F)(F)F)C=CC1Cl

Synonyms:

• 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxamide
• 2-Pyridinecarboxamide, 3-chloro-6-(trifluoromethyl)-