CAS 1279815-98-3

1-(Phenylmethyl)-3-(2,2,2-trifluoroethyl)piperazine

Description:

1-(Phenylmethyl)-3-(2,2,2-trifluoroethyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a phenylmethyl group and a trifluoroethyl substituent contributes to its unique properties. The trifluoroethyl group enhances lipophilicity and may influence the compound's biological activity, making it of interest in medicinal chemistry. This compound may exhibit various pharmacological effects due to its structural features, potentially interacting with neurotransmitter systems. Its molecular structure suggests it could be a candidate for research in areas such as neuropharmacology or drug development. Additionally, the trifluoromethyl group is known for its ability to modulate the electronic properties of the molecule, which can affect its reactivity and stability. As with many piperazine derivatives, it may also exhibit potential as a scaffold for further chemical modifications. Safety and handling precautions should be observed, as with all chemical substances, particularly those with fluorinated groups, which can pose environmental and health risks.

Formula: C₁₃H₁₇F₃N₂

InChI: InChI=1S/C13H17F3N2/c14-13(15,16)8-12-10-18(7-6-17-12)9-11-4-2-1-3-5-11/h1-5,12,17H,6-10H2

InChI key: InChIKey=BOTLGUSCALHYGW-UHFFFAOYSA-N

SMILES: C(N1CC(CC(F)(F)F)NCC1)C2=CC=CC=C2

Synonyms:

• Piperazine, 1-(phenylmethyl)-3-(2,2,2-trifluoroethyl)-
• 1-(Phenylmethyl)-3-(2,2,2-trifluoroethyl)piperazine