CAS 1279852-41-3

Benzeneethanamine, α-(3,5-dichlorophenyl)-, hydrochloride (1:1)

Description:

Benzeneethanamine, α-(3,5-dichlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and the presence of a dichlorophenyl substituent. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the dichlorophenyl group suggests potential applications in pharmaceuticals or agrochemicals, as halogenated aromatic compounds often exhibit unique biological activities. The compound's structure indicates it may interact with biological systems, potentially influencing neurotransmitter pathways or exhibiting other pharmacological effects. Safety data should be consulted, as compounds with amine groups can be irritants or toxic in certain contexts. Proper handling and storage conditions are essential to ensure stability and minimize exposure risks. As with any chemical, thorough understanding of its properties, reactivity, and safety profile is crucial for its application in research or industry.

Formula: C₁₄H₁₃Cl₂N·ClH

InChI: InChI=1S/C14H13Cl2N.ClH/c15-12-7-11(8-13(16)9-12)14(17)6-10-4-2-1-3-5-10;/h1-5,7-9,14H,6,17H2;1H

InChI key: InChIKey=MKHYOLXDPKHKCL-UHFFFAOYSA-N

SMILES: C(CC1=CC=CC=C1)(N)C2=CC(Cl)=CC(Cl)=C2.Cl

Synonyms:

• Benzeneethanamine, α-(3,5-dichlorophenyl)-, hydrochloride (1:1)

1-(3,5-Dichlorophenyl)-2-phenylethan-1-amine hydrochloride

CAS: 1279852-41-3

Versatile small molecule scaffold

Formula: C₁₄H₁₄Cl₃N

Purity: Min. 95%

Molecular weight: 302.6 g/mol

Ref: 3D-EBC85241