
CAS 128-55-2
:2,6-Diamino-4-methylbenzenesulfonic acid
Description:
2,6-Diamino-4-methylbenzenesulfonic acid, also known as sulfanilic acid, is an aromatic sulfonic acid characterized by its sulfonic acid group (-SO3H) attached to a benzene ring that also contains two amino groups (-NH2) and a methyl group (-CH3). This compound is typically a white to light yellow crystalline solid, highly soluble in water due to the presence of the sulfonic acid group, which enhances its polarity. It exhibits both acidic and basic properties, allowing it to participate in various chemical reactions, including diazotization, which is crucial in dye synthesis. The amino groups can act as nucleophiles, making the compound reactive in electrophilic substitution reactions. 2,6-Diamino-4-methylbenzenesulfonic acid is primarily used in the manufacture of azo dyes and as a reagent in analytical chemistry. It is important to handle this compound with care, as it may pose health risks upon exposure, including potential skin and respiratory irritation.
Formula:C7H10N2O3S
InChI:InChI=1S/C7H10N2O3S/c1-4-2-5(8)7(6(9)3-4)13(10,11)12/h2-3H,8-9H2,1H3,(H,10,11,12)
InChI key:InChIKey=MNAWGAORJBFMTQ-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=C(N)C=C(C)C=C1N
Synonyms:- 2,6-Diamino-p-toluenesulfonic acid
- NSC 7836
- 2,6-Diamino-4-methylbenzenesulfonic acid
- Benzenesulfonic acid, 2,6-diamino-4-methyl-
- p-Toluenesulfonic acid, 2,6-diamino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
