
CAS 128-83-6
:1-Amino-2-bromo-4-[(4-methylphenyl)amino]-9,10-anthracenedione
Description:
1-Amino-2-bromo-4-[(4-methylphenyl)amino]-9,10-anthracenedione, with CAS number 128-83-6, is an organic compound that belongs to the class of anthraquinones. This substance features a complex structure characterized by an anthracene backbone, which is a polycyclic aromatic hydrocarbon, and contains both amino and bromo functional groups. The presence of the amino group contributes to its potential as a dye or pigment, while the bromo substituent can influence its reactivity and solubility. The 4-methylphenylamino group enhances its electronic properties, making it suitable for various applications in organic electronics and dye chemistry. This compound is typically characterized by its color, solubility in organic solvents, and its ability to undergo various chemical reactions, including substitution and reduction. Its unique structure and functional groups may also impart biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as compounds of this nature can pose health risks if not handled properly.
Formula:C21H15BrN2O2
InChI:InChI=1S/C21H15BrN2O2/c1-11-6-8-12(9-7-11)24-16-10-15(22)19(23)18-17(16)20(25)13-4-2-3-5-14(13)21(18)26/h2-10,24H,23H2,1H3
InChI key:InChIKey=SPDRRRCQUXHHLH-UHFFFAOYSA-N
SMILES:N(C1=C2C(C(=O)C=3C(C2=O)=CC=CC3)=C(N)C(Br)=C1)C4=CC=C(C)C=C4
Synonyms:- 9,10-Anthracenedione, 1-amino-2-bromo-4-[(4-methylphenyl)amino]-
- Ahcoquinone Sky Blue B Base
- C.I. 62100
- Anthraquinone, 1-amino-2-bromo-4-p-toluidino-
- 1-Amino-2-bromo-4-[(4-methylphenyl)amino]-9,10-anthracenedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
C.I. 62100
CAS:C.I. 62100 is a biochemical.Formula:C21H15BrN2O2Color and Shape:SolidMolecular weight:407.26
