CymitQuimica logo

CAS 128-84-7

:

1,4-Diamino-2,3-dihydroxy-9,10-anthracenedione

Description:
1,4-Diamino-2,3-dihydroxy-9,10-anthracenedione, commonly known as anthraquinone-2,3-diamine, is an organic compound characterized by its anthraquinone structure, which consists of a three-ring aromatic system. This compound features two amino groups and two hydroxyl groups, contributing to its reactivity and solubility in various solvents. It is typically a dark-colored solid and is known for its applications in dye manufacturing, particularly in the textile industry, due to its ability to form vibrant colors. The presence of amino and hydroxyl groups allows for hydrogen bonding and enhances its interaction with other chemical species. Additionally, this compound exhibits potential biological activity, making it of interest in medicinal chemistry. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Safety considerations should be taken into account when handling this substance, as it may pose health risks upon exposure. Overall, 1,4-Diamino-2,3-dihydroxy-9,10-anthracenedione is a versatile compound with significant industrial and research relevance.
Formula:C14H10N2O4
InChI:InChI=1S/C14H10N2O4/c15-9-7-8(10(16)14(20)13(9)19)12(18)6-4-2-1-3-5(6)11(7)17/h1-4,19-20H,15-16H2
InChI key:InChIKey=OFIYINUGSZSGAW-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC=CC3)=C(N)C(O)=C(O)C2N
Synonyms:
  • 1,4-Diamino-2,3-dihydroxyanthraquinone
  • Anthraquinone, 1,4-diamino-2,3-dihydroxy-
  • 9,10-Anthracenedione, 1,4-diamino-2,3-dihydroxy-
  • 1,4-Diamino-2,3-dihydroxy-9,10-anthracenedione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.