
CAS 128-89-2
:N-[4-[[5-(Benzoylamino)-9,10-dihydro-9,10-dioxo-1-anthracenyl]amino]-9,10-dihydro-9,10-dioxo-1-anthracenyl]benzamide
Description:
N-[4-[[5-(Benzoylamino)-9,10-dihydro-9,10-dioxo-1-anthracenyl]amino]-9,10-dihydro-9,10-dioxo-1-anthracenyl]benzamide, with CAS number 128-89-2, is a synthetic organic compound characterized by its complex structure, which includes anthracene derivatives and amide functional groups. This compound exhibits properties typical of anthracene derivatives, such as strong fluorescence and potential applications in organic electronics and photonic devices. Its structure suggests it may have significant interactions with biological systems, making it of interest in medicinal chemistry, particularly in the development of anticancer agents due to the presence of the anthracene moiety, which is known for its ability to intercalate with DNA. The compound is likely to be insoluble in water but soluble in organic solvents, which is common for large polycyclic aromatic compounds. Safety and handling precautions should be observed, as compounds with similar structures can exhibit toxicity or environmental persistence. Further studies would be necessary to fully elucidate its biological activity and potential applications.
Formula:C42H25N3O6
InChI:InChI=1S/C42H25N3O6/c46-37-25-15-7-8-16-26(25)38(47)36-32(45-42(51)24-13-5-2-6-14-24)22-21-31(35(36)37)43-29-19-9-17-27-33(29)39(48)28-18-10-20-30(34(28)40(27)49)44-41(50)23-11-3-1-4-12-23/h1-22,43H,(H,44,50)(H,45,51)
InChI key:InChIKey=HZCNWAWXJDZEHZ-UHFFFAOYSA-N
SMILES:N(C1=C2C(=C(NC(=O)C3=CC=CC=C3)C=C1)C(=O)C=4C(C2=O)=CC=CC4)C5=C6C(C(=O)C=7C(C6=O)=CC=CC7NC(=O)C8=CC=CC=C8)=CC=C5
Synonyms:- N-[4-[[5-(Benzoylamino)-9,10-dihydro-9,10-dioxo-1-anthracenyl]amino]-9,10-dihydro-9,10-dioxo-1-anthracenyl]benzamide
- Anthraquinone, 4,5′-dibenzamido-1,1′-iminodi-
- Indanthrene Brown RY
- Benzamide, N-[4-[[5-(benzoylamino)-9,10-dihydro-9,10-dioxo-1-anthracenyl]amino]-9,10-dihydro-9,10-dioxo-1-anthracenyl]-
- 4,5′-Dibenzamido-1,1′-iminodianthraquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzamide, N-[4-[[5-(benzoylamino)-9,10-dihydro-9,10-dioxo-1-anthracenyl]amino]-9,10-dihydro-9,10-dioxo-1-anthracenyl]-
CAS:Formula:C42H25N3O6Molecular weight:667.6644
