
CAS 128-98-3
:1-Amino-9,10-dihydro-4-[[(4-methylphenyl)sulfonyl]amino]-9,10-dioxo-2-anthracenesulfonic acid
Description:
1-Amino-9,10-dihydro-4-[[(4-methylphenyl)sulfonyl]amino]-9,10-dioxo-2-anthracenesulfonic acid, with CAS number 128-98-3, is a synthetic organic compound that belongs to the class of anthraquinone derivatives. This compound features a complex structure characterized by an anthracene backbone, which is a polycyclic aromatic hydrocarbon, and contains multiple functional groups, including amino and sulfonyl groups. These functional groups contribute to its solubility and reactivity, making it useful in various applications, particularly in dye chemistry and as a potential intermediate in organic synthesis. The presence of sulfonic acid groups enhances its water solubility, which is advantageous for its use in aqueous environments. Additionally, the compound exhibits potential biological activity, which may be explored in pharmaceutical contexts. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, this compound is notable for its structural complexity and potential utility in both industrial and research settings.
Formula:C21H16N2O7S2
InChI:InChI=1S/C21H16N2O7S2/c1-11-6-8-12(9-7-11)31(26,27)23-15-10-16(32(28,29)30)19(22)18-17(15)20(24)13-4-2-3-5-14(13)21(18)25/h2-10,23H,22H2,1H3,(H,28,29,30)
InChI key:InChIKey=IIZQAPDECJYKDK-UHFFFAOYSA-N
SMILES:N(S(=O)(=O)C1=CC=C(C)C=C1)C2=C3C(C(=O)C=4C(C3=O)=CC=CC4)=C(N)C(S(=O)(=O)O)=C2
Synonyms:- 2-Anthracenesulfonic acid, 1-amino-9,10-dihydro-4-[[(4-methylphenyl)sulfonyl]amino]-9,10-dioxo-
- 2-Anthracenesulfonic acid, 1-amino-9,10-dihydro-9,10-dioxo-4-p-toluenesulfonamido-
- 1-Amino-9,10-dihydro-4-[[(4-methylphenyl)sulfonyl]amino]-9,10-dioxo-2-anthracenesulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Anthracenesulfonic acid, 1-amino-9,10-dihydro-4-[[(4-methylphenyl)sulfonyl]amino]-9,10-dioxo-
CAS:Formula:C21H16N2O7S2Molecular weight:472.4909
