CymitQuimica logo

CAS 128-99-4

:

1-Amino-4-[(3-amino-4-sulfophenyl)amino]-9,10-dihydro-9,10-dioxo-2-anthracenesulfonic acid

Description:
1-Amino-4-[(3-amino-4-sulfophenyl)amino]-9,10-dihydro-9,10-dioxo-2-anthracenesulfonic acid, commonly referred to as a type of anthraquinone dye, is characterized by its complex molecular structure that includes multiple functional groups, such as amino and sulfonic acid groups. This compound is typically used in dyeing processes due to its vibrant color and excellent solubility in water, which enhances its application in various industries, including textiles and paper. The presence of sulfonic acid groups contributes to its high water solubility and helps in the formation of stable dye solutions. Additionally, the amino groups can participate in various chemical reactions, making this compound versatile in synthetic applications. Its structure allows for strong interactions with substrates, leading to good fixation properties in dyeing. However, like many synthetic dyes, it may pose environmental concerns, necessitating careful handling and disposal. Overall, this compound exemplifies the intricate relationship between molecular structure and functional properties in chemical substances used in industrial applications.
Formula:C20H15N3O8S2
InChI:InChI=1S/C20H15N3O8S2/c21-12-7-9(5-6-14(12)32(26,27)28)23-13-8-15(33(29,30)31)18(22)17-16(13)19(24)10-3-1-2-4-11(10)20(17)25/h1-8,23H,21-22H2,(H,26,27,28)(H,29,30,31)
InChI key:InChIKey=ZOHPJXCEVYGLJT-UHFFFAOYSA-N
SMILES:N(C1=C2C(C(=O)C=3C(C2=O)=CC=CC3)=C(N)C(S(=O)(=O)O)=C1)C4=CC(N)=C(S(=O)(=O)O)C=C4
Synonyms:
  • 2-Anthracenesulfonic acid, 1-amino-4-(3-amino-4-sulfoanilino)-9,10-dihydro-9,10-dioxo-
  • 1-Amino-4-(3′-aminophenylamino)anthraquinone-2,4′-disulfonic acid
  • 2-Anthracenesulfonic acid, 1-amino-4-[(3-amino-4-sulfophenyl)amino]-9,10-dihydro-9,10-dioxo-
  • 1-Amino-4-[(3-amino-4-sulfophenyl)amino]-9,10-dihydro-9,10-dioxo-2-anthracenesulfonic acid
  • 1-Amino-4-(3-amino-4-sulfoanilino)-2-anthraquinonesulfonic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.