CymitQuimica logo

CAS 128009-34-7

:

2-Ethynyl-5-(trifluoromethyl)thiophene

Description:
2-Ethynyl-5-(trifluoromethyl)thiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of an ethynyl group at the 2-position introduces a triple bond, enhancing its reactivity and potential applications in organic synthesis. The trifluoromethyl group at the 5-position significantly influences the compound's electronic properties, making it more electron-deficient and potentially increasing its utility in various chemical reactions, including electrophilic substitutions. This compound is typically used in the synthesis of more complex organic molecules and may exhibit interesting optical and electronic properties, making it relevant in materials science and organic electronics. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Safety and handling precautions should be observed, as with many fluorinated compounds, due to potential toxicity and environmental concerns.
Formula:C7H3F3S
InChI:InChI=1S/C7H3F3S/c1-2-5-3-4-6(11-5)7(8,9)10/h1,3-4H
InChI key:InChIKey=XZBLWVVVUBTLLB-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1SC(C#C)=CC1
Synonyms:
  • 2-Ethynyl-5-(trifluoromethyl)thiophene
  • Thiophene, 2-ethynyl-5-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.