CAS 128013-65-0
:ethyl 5-methyl-3-(nitromethyl)hexanoate
Description:
Ethyl 5-methyl-3-(nitromethyl)hexanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethanol) and a carboxylic acid. This compound features a hexanoate backbone with a methyl group and a nitromethyl substituent, contributing to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. Ethyl 5-methyl-3-(nitromethyl)hexanoate may exhibit moderate polarity due to the ester and nitro groups, influencing its solubility in organic solvents. Additionally, the compound's structure suggests potential applications in synthetic organic chemistry, possibly as an intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed, as nitro compounds can be sensitive and may pose health risks. Overall, this compound represents a specific class of esters with interesting chemical behavior and potential utility in various chemical processes.
Formula:C10H19NO4
InChI:InChI=1/C10H19NO4/c1-4-15-10(12)6-9(5-8(2)3)7-11(13)14/h8-9H,4-7H2,1-3H3
SMILES:CCOC(=O)CC(CC(C)C)CN(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
5-Methyl-3-(nitromethyl)hexanoic Acid Ethyl Ester
CAS:Formula:C10H19NO4Color and Shape:LiquidMolecular weight:217.26225-Methyl-3-(nitromethyl)hexanoic Acid Ethyl Ester
CAS:Controlled ProductApplications Pregabalin intermediate.
References Decicco, C., et al.: Bioorg. Med. Chem. Lett., 7, 2331 (1997),Formula:C10H19NO4Color and Shape:ColourlessMolecular weight:217.26



