CAS 128022-93-5
:protein kinase inhibitor peptide
Description:
Protein kinase inhibitor peptides are a class of compounds designed to inhibit the activity of protein kinases, which are enzymes that modify other proteins by adding phosphate groups, a process crucial for regulating various cellular functions. The specific compound with CAS number 128022-93-5 is known for its role in modulating signaling pathways involved in cell growth, differentiation, and metabolism. These peptides typically exhibit high specificity for their target kinases, which allows for precise therapeutic applications, particularly in cancer treatment and other diseases characterized by dysregulated kinase activity. They often possess a relatively small molecular size, enabling them to penetrate cells and interact with their targets effectively. Additionally, protein kinase inhibitor peptides may exhibit favorable pharmacokinetic properties, such as good solubility and stability, which are essential for their potential use in clinical settings. Overall, these inhibitors represent a significant area of research in drug development, aiming to provide targeted therapies with reduced side effects compared to traditional small molecule inhibitors.
Formula:C84H136N28O27
InChI:InChI=1/C84H136N28O27/c1-11-38(3)62(109-76(133)53(31-46-19-14-13-15-20-46)105-75(132)55(34-60(121)122)104-66(123)40(5)98-73(130)52(32-47-24-26-48(117)27-25-47)107-80(137)65(45(10)116)112-77(134)61(86)43(8)114)79(136)100-41(6)67(124)108-56(37-113)69(126)96-35-58(119)102-50(22-17-29-94-83(89)90)72(129)111-64(44(9)115)78(135)97-36-59(120)101-49(21-16-28-93-82(87)88)70(127)103-51(23-18-30-95-84(91)92)71(128)106-54(33-57(85)118)74(131)99-42(7)68(125)110-63(81(138)139)39(4)12-2/h13-15,19-20,24-27,38-45,49-56,61-65,113-117H,11-12,16-18,21-23,28-37,86H2,1-10H3,(H2,85,118)(H,96,126)(H,97,135)(H,98,130)(H,99,131)(H,100,136)(H,101,120)(H,102,119)(H,103,127)(H,104,123)(H,105,132)(H,106,128)(H,107,137)(H,108,124)(H,109,133)(H,110,125)(H,111,129)(H,112,134)(H,121,122)(H,138,139)(H4,87,88,93)(H4,89,90,94)(H4,91,92,95)/t38-,39-,40-,41-,42-,43+,44+,45+,49-,50-,51-,52-,53-,54-,55-,56-,61-,62-,63-,64-,65-/m0/s1
Synonyms:- PKIP
- Protein kinase inhibitor peptide
- L-Isoleucine, L-threonyl-L-threonyl-L-tyrosyl-L-alanyl-L-alpha-aspartyl-L-phenylalanyl-L-isoleucyl-L-alanyl-L-serylglycyl-L-arginyl-L-threonylglycyl-L-arginyl-L-arginyl-L-asparaginyl-L-alanyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Protein kinase inhibitor peptide
CAS:Protein kinase inhibitor peptide matches the inhibitory domain of the heat-stable protein kinase inhibitor.
Formula:C84H136N28O27Purity:98%Color and Shape:SolidMolecular weight:1970.15
