CymitQuimica logo

CAS 128023-59-6

:

Formic acid, compd. with N,N-dimethyl-1-hexadecanamine (1:1)

Description:
Formic acid, compd. with N,N-dimethyl-1-hexadecanamine (1:1), is a chemical compound characterized by its unique combination of a carboxylic acid and a long-chain amine. This compound typically exhibits properties associated with both its components: formic acid contributes acidity and potential reactivity, while N,N-dimethyl-1-hexadecanamine imparts hydrophobic characteristics due to its long hydrocarbon chain. The presence of the amine can enhance solubility in organic solvents and may facilitate interactions with biological membranes. This compound may also exhibit surfactant properties, making it useful in various applications, including emulsification and stabilization in formulations. Additionally, the combination of a polar functional group (the carboxylic acid) and a non-polar hydrocarbon chain can lead to interesting behavior in mixed systems, potentially influencing the compound's role in biochemical processes or industrial applications. Safety considerations should be taken into account, as both formic acid and long-chain amines can pose hazards if not handled properly.
Formula:C18H39N·CH2O2
InChI:InChI=1S/C18H39N.CH2O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3;2-1-3/h4-18H2,1-3H3;1H,(H,2,3)
InChI key:InChIKey=YHLGXPMEHMBUHD-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC)CCCCN(C)C.C(O)=O
Synonyms:
  • Formic acid, compd. with N,N-dimethyl-1-hexadecanamine (1:1)
  • 1-Hexadecanamine, N,N-dimethyl-, formate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.