CAS 128043-98-1
:3-[(3,4-Dichlorophenyl)methyl]-2,4,5-trioxo-1-imidazolidineacetic acid
Description:
3-[(3,4-Dichlorophenyl)methyl]-2,4,5-trioxo-1-imidazolidineacetic acid, with CAS number 128043-98-1, is a chemical compound characterized by its imidazolidine structure, which incorporates a carboxylic acid functional group and multiple carbonyl groups. The presence of the 3,4-dichlorophenyl moiety indicates that it has significant aromatic characteristics, contributing to its potential biological activity. This compound is likely to exhibit properties such as moderate solubility in polar solvents due to the presence of both hydrophilic and hydrophobic regions. Its trioxo structure suggests that it may participate in various chemical reactions, including nucleophilic attacks and redox processes. Additionally, the imidazolidine ring may confer stability and influence its reactivity. Given its structural features, this compound could have applications in pharmaceuticals or agrochemicals, although specific biological activities would depend on further empirical studies. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated aromatic components.
Formula:C12H8Cl2N2O5
InChI:InChI=1S/C12H8Cl2N2O5/c13-7-2-1-6(3-8(7)14)4-15-10(19)11(20)16(12(15)21)5-9(17)18/h1-3H,4-5H2,(H,17,18)
InChI key:InChIKey=OOYXYHJPQAORHT-UHFFFAOYSA-N
SMILES:C(N1C(=O)N(CC(O)=O)C(=O)C1=O)C2=CC(Cl)=C(Cl)C=C2
Synonyms:- 1-Imidazolidineacetic acid, 3-[(3,4-dichlorophenyl)methyl]-2,4,5-trioxo-
- 3-[(3,4-Dichlorophenyl)methyl]-2,4,5-trioxo-1-imidazolidineacetic acid
- 2-[3-(3,4-DICHLOROBENZYL)-2,4,5-TRIOXO-1-IMIDAZOLIDINYL]ACETIC ACID
- 2-(3-(3,4-Dichlorobenzyl)-2,4,5-trioxoimidazolidin-1-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.