
CAS 128050-98-6
:Boc-D-Anthrylalanine
Description:
Boc-D-Anthrylalanine is a synthetic amino acid derivative characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group and an anthracene moiety attached to the alanine structure. This compound is primarily utilized in peptide synthesis and research involving fluorescence due to the anthracene group, which can exhibit strong light absorption and emission properties. The Boc group serves as a protective group for the amino functionality, allowing for selective reactions during peptide assembly. The presence of the anthracene ring enhances the compound's photophysical properties, making it valuable in studies related to molecular recognition, drug design, and materials science. Additionally, Boc-D-Anthrylalanine can be involved in the development of novel biomaterials and probes for biological applications. Its unique structural features contribute to its utility in various chemical and biochemical contexts, particularly in the exploration of peptide interactions and the design of fluorescent labels.
Formula:C22H23NO4
InChI:InChI=1/C22H23NO4/c1-22(2,3)27-21(26)23-19(20(24)25)13-18-16-10-6-4-8-14(16)12-15-9-5-7-11-17(15)18/h4-12,19H,13H2,1-3H3,(H,23,26)(H,24,25)/t19-/m1/s1
SMILES:CC(C)(C)OC(=N[C@H](Cc1c2ccccc2cc2ccccc12)C(=O)O)O
Synonyms:- 3-anthracen-9-yl-N-(tert-butoxycarbonyl)-D-alanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-3-(Anthracen-9-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid
CAS:Formula:C22H23NO4Molecular weight:365.4223
