CAS 128057-44-3
:3-Methyleneheptadecane
Description:
3-Methyleneheptadecane is a long-chain hydrocarbon classified as an alkene due to the presence of a double bond in its structure. Specifically, it features a methylene group (-CH2-) at the third carbon position of a heptadecane backbone, which consists of 17 carbon atoms. This compound is part of the larger family of aliphatic hydrocarbons and exhibits characteristics typical of such substances, including being non-polar and hydrophobic. Its molecular structure contributes to its relatively low reactivity compared to other functionalized organic compounds. 3-Methyleneheptadecane is likely to be a colorless liquid at room temperature, with a boiling point that is higher than that of shorter-chain alkenes due to increased molecular weight. It may be used in various applications, including as a chemical intermediate in organic synthesis or in the production of surfactants. However, specific data on its physical and chemical properties, such as melting point, boiling point, and solubility, would require experimental determination or reference to specialized chemical databases.
Formula:C18H36
InChI:InChI=1S/C18H36/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18(3)5-2/h3-17H2,1-2H3
InChI key:InChIKey=LCFDRPQKZJDBHH-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC)CCC(CC)=C
Synonyms:- Heptadecane, 3-methylene-
- 2-Ethyl-1-hexadecene
- 3-Methyleneheptadecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
