CAS 128073-02-9
:3-Chloro-2-pyridinecarbonyl chloride
Description:
3-Chloro-2-pyridinecarbonyl chloride, with the CAS number 128073-02-9, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carbonyl chloride functional group, indicating the presence of a carbonyl (C=O) bonded to a chlorine atom. It is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of the chlorine atom and the carbonyl group suggests that it may exhibit reactivity typical of acyl chlorides, such as nucleophilic acyl substitution. This compound is often used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Its reactivity can make it a useful intermediate in the synthesis of more complex molecules. However, due to the presence of chlorine and the potential for hydrolysis, it should be handled with care, following appropriate safety protocols to mitigate risks associated with its chemical properties.
Formula:C6H3Cl2NO
InChI:InChI=1S/C6H3Cl2NO/c7-4-2-1-3-9-5(4)6(8)10/h1-3H
InChI key:InChIKey=ZAFLZRNJFHWOQQ-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C(Cl)C=CC=N1
Synonyms:- 2-Pyridinecarbonyl chloride, 3-chloro-
- 3-Chloropyridine-2-carbonyl chloride
- 3-Chloro-2-pyridinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Chloropyridine-2-carbonyl chloride
CAS:3-Chloropyridine-2-carbonyl chloridePurity:techMolecular weight:176.00g/mol

