CymitQuimica logo

CAS 128073-10-9

:

3-Chloro-5-methoxy-2-pyridinecarbonyl chloride

Description:
3-Chloro-5-methoxy-2-pyridinecarbonyl chloride is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group at the 3-position and a methoxy group at the 5-position contributes to its reactivity and solubility properties. The carbonyl chloride functional group, also known as an acyl chloride, is highly reactive, making this compound useful in various synthetic applications, particularly in the formation of amides and esters. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions. This compound is often handled with care due to its potential to release hydrochloric acid upon hydrolysis, which can be corrosive. Additionally, it may exhibit moderate toxicity, necessitating appropriate safety measures during handling and use. Its applications can span across pharmaceuticals, agrochemicals, and other organic synthesis processes, where it serves as an important intermediate.
Formula:C7H5Cl2NO2
InChI:InChI=1S/C7H5Cl2NO2/c1-12-4-2-5(8)6(7(9)11)10-3-4/h2-3H,1H3
InChI key:InChIKey=AUBFALJKMLSQAW-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C(Cl)C=C(OC)C=N1
Synonyms:
  • 3-Chloro-5-methoxy-2-pyridinecarbonyl chloride
  • 2-Pyridinecarbonyl chloride, 3-chloro-5-methoxy-
  • 3-Chloro-5-methoxypicolinoyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.