CAS 128076-64-2
:1-(2-Amino-5-fluorophenyl)-2-chloroethanone
Description:
1-(2-Amino-5-fluorophenyl)-2-chloroethanone, with the CAS number 128076-64-2, is a chemical compound characterized by its unique functional groups and structural features. It contains an amino group (-NH2) and a chloro group (-Cl) attached to an ethanone moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the fluorine atom enhances its electronic properties, making it a valuable intermediate in the development of pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to its polar functional groups. Its reactivity can be attributed to the electrophilic nature of the carbonyl group and the nucleophilic potential of the amino group, allowing for various chemical transformations. Safety data should be consulted for handling, as it may pose health risks, including irritation or toxicity. Overall, this compound is of interest in medicinal chemistry and material science for its potential biological activities and synthetic utility.
Formula:C8H7ClFNO
InChI:InChI=1S/C8H7ClFNO/c9-4-8(12)6-3-5(10)1-2-7(6)11/h1-3H,4,11H2
InChI key:InChIKey=IZAPRVJOMNGPLC-UHFFFAOYSA-N
SMILES:C(CCl)(=O)C1=C(N)C=CC(F)=C1
Synonyms:- 1-(2-Amino-5-fluorophenyl)-2-chloroethanone
- 2′-Amino-2-chloro-5′-fluoroacetophenone
- 1-(2-Amino-5-fluorophenyl)-2-chloroethan-1-one
- Ethanone, 1-(2-amino-5-fluorophenyl)-2-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
