CymitQuimica logo

CAS 1280786-60-8

:

4-Bromo-N-ethyl-5-methoxy-2-nitrobenzenamine

Description:
4-Bromo-N-ethyl-5-methoxy-2-nitrobenzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, an ethyl group, a methoxy group, and a nitro group attached to a benzene ring. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution. The methoxy group enhances the compound's solubility in organic solvents and can influence its electronic properties, while the nitro group is known for its electron-withdrawing effects, which can affect the compound's reactivity and stability. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis and material science. Safety and handling precautions should be observed due to the presence of the nitro group, which can pose health risks. Overall, 4-Bromo-N-ethyl-5-methoxy-2-nitrobenzenamine is a versatile compound with significant implications in both chemical research and industrial applications.
Formula:C9H11BrN2O3
InChI:InChI=1S/C9H11BrN2O3/c1-3-11-7-5-9(15-2)6(10)4-8(7)12(13)14/h4-5,11H,3H2,1-2H3
InChI key:InChIKey=VYNXNDSCAJEVEN-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(NCC)C=C(OC)C(Br)=C1
Synonyms:
  • Benzenamine, 4-bromo-N-ethyl-5-methoxy-2-nitro-
  • 4-Bromo-N-ethyl-5-methoxy-2-nitrobenzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.