CAS 1280786-63-1
:4-Bromo-N-butyl-5-fluoro-2-nitrobenzenamine
Description:
4-Bromo-N-butyl-5-fluoro-2-nitrobenzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, a fluorine atom, and a nitro group attached to a benzene ring. The presence of the butyl group contributes to its hydrophobic characteristics, while the nitro group introduces polarity, affecting its solubility and reactivity. This compound is likely to exhibit moderate to high stability under standard conditions, but it may be sensitive to strong acids or bases due to the presence of the amino group. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups can play a role in biological activity. The compound's reactivity can be influenced by the electron-withdrawing effects of the nitro and fluoro groups, which may enhance its electrophilic character. Additionally, the bromine atom can serve as a site for further chemical modifications, making it a versatile intermediate in synthetic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C10H12BrFN2O2
InChI:InChI=1S/C10H12BrFN2O2/c1-2-3-4-13-9-6-8(12)7(11)5-10(9)14(15)16/h5-6,13H,2-4H2,1H3
InChI key:InChIKey=MADGKUFFNLQJMI-UHFFFAOYSA-N
SMILES:N(CCCC)C1=C(N(=O)=O)C=C(Br)C(F)=C1
Synonyms:- Benzenamine, 4-bromo-N-butyl-5-fluoro-2-nitro-
- 4-Bromo-N-butyl-5-fluoro-2-nitrobenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
